C7H10N4O3 — CID 46737744
3-ethyl-4-(methoxyamino)-2,5-dioxoimidazolidine-4-carbonitrile (PubChem CID 46737744) has the molecular formula C7H10N4O3 and a molecular weight of 198.18 g/mol. Its IUPAC name is 3-ethyl-4-(methoxyamino)-2,5-dioxoimidazolidine-4-carbonitrile.
| Compound Name | 3-ethyl-4-(methoxyamino)-2,5-dioxoimidazolidine-4-carbonitrile |
|---|---|
| PubChem CID | 46737744 |
| Molecular Formula | C7H10N4O3 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 3-ethyl-4-(methoxyamino)-2,5-dioxoimidazolidine-4-carbonitrile |
| SMILES | CCN1C(=O)NC(=O)C1(C#N)NOC |
| InChI | InChI=1S/C7H10N4O3/c1-3-11-6(13)9-5(12)7(11,4-8)10-14-2/h10H,3H2,1-2H3,(H,9,12,13) |
| InChIKey | UHLOZXUJVHDKAG-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|