C8H13N3O4 — CID 60717947
2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-methoxyacetamide (PubChem CID 60717947) has the molecular formula C8H13N3O4 and a molecular weight of 215.21 g/mol. Its IUPAC name is 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-methoxyacetamide.
| Compound Name | 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-methoxyacetamide |
|---|---|
| PubChem CID | 60717947 |
| Molecular Formula | C8H13N3O4 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-methoxyacetamide |
| SMILES | CONC(=O)CN1C(=O)NC(C)(C)C1=O |
| InChI | InChI=1S/C8H13N3O4/c1-8(2)6(13)11(7(14)9-8)4-5(12)10-15-3/h4H2,1-3H3,(H,9,14)(H,10,12) |
| InChIKey | KMBYGLSBWQJYOX-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|