C14H13N3O3 — CID 43289205
2-[3-(3,6-dioxo-1H-pyridazin-2-yl)propoxy]benzonitrile (PubChem CID 43289205) has the molecular formula C14H13N3O3 and a molecular weight of 271.28 g/mol. Its IUPAC name is 2-[3-(3,6-dioxo-1H-pyridazin-2-yl)propoxy]benzonitrile.
| Compound Name | 2-[3-(3,6-dioxo-1H-pyridazin-2-yl)propoxy]benzonitrile |
|---|---|
| PubChem CID | 43289205 |
| Molecular Formula | C14H13N3O3 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 2-[3-(3,6-dioxo-1H-pyridazin-2-yl)propoxy]benzonitrile |
| SMILES | N#Cc1ccccc1OCCCn1[nH]c(=O)ccc1=O |
| InChI | InChI=1S/C14H13N3O3/c15-10-11-4-1-2-5-12(11)20-9-3-8-17-14(19)7-6-13(18)16-17/h1-2,4-7H,3,8-9H2,(H,16,18) |
| InChIKey | FNNSNWHFVXKSNG-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 87.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|