C16H10BrNO3 — CID 43321355
1-(5-bromo-1-benzofuran-2-yl)-3-pyridin-3-ylpropane-1,3-dione (PubChem CID 43321355) has the molecular formula C16H10BrNO3 and a molecular weight of 344.16 g/mol. Its IUPAC name is 1-(5-bromo-1-benzofuran-2-yl)-3-pyridin-3-ylpropane-1,3-dione.
| Compound Name | 1-(5-bromo-1-benzofuran-2-yl)-3-pyridin-3-ylpropane-1,3-dione |
|---|---|
| PubChem CID | 43321355 |
| Molecular Formula | C16H10BrNO3 |
| Molecular Weight | 344.16 g/mol |
| Exact Mass | 342.98 |
| IUPAC Name | 1-(5-bromo-1-benzofuran-2-yl)-3-pyridin-3-ylpropane-1,3-dione |
| SMILES | O=C(CC(=O)c1cc2cc(Br)ccc2o1)c1cccnc1 |
| InChI | InChI=1S/C16H10BrNO3/c17-12-3-4-15-11(6-12)7-16(21-15)14(20)8-13(19)10-2-1-5-18-9-10/h1-7,9H,8H2 |
| InChIKey | JKRVABXXSXVSKA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.16 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|