C16H17BrO3 — CID 43321144
1-(5-bromo-1-benzofuran-2-yl)octane-1,3-dione (PubChem CID 43321144) has the molecular formula C16H17BrO3 and a molecular weight of 337.21 g/mol. Its IUPAC name is 1-(5-bromo-1-benzofuran-2-yl)octane-1,3-dione.
| Compound Name | 1-(5-bromo-1-benzofuran-2-yl)octane-1,3-dione |
|---|---|
| PubChem CID | 43321144 |
| Molecular Formula | C16H17BrO3 |
| Molecular Weight | 337.21 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 1-(5-bromo-1-benzofuran-2-yl)octane-1,3-dione |
| SMILES | CCCCCC(=O)CC(=O)c1cc2cc(Br)ccc2o1 |
| InChI | InChI=1S/C16H17BrO3/c1-2-3-4-5-13(18)10-14(19)16-9-11-8-12(17)6-7-15(11)20-16/h6-9H,2-5,10H2,1H3 |
| InChIKey | KKRYKIVOSGQGSX-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.21 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|