C12H12ClNO3S — CID 43326970
2-(1-chloroethyl)-5-(4-methylsulfonylphenyl)-1,3-oxazole (PubChem CID 43326970) has the molecular formula C12H12ClNO3S and a molecular weight of 285.75 g/mol. Its IUPAC name is 2-(1-chloroethyl)-5-(4-methylsulfonylphenyl)-1,3-oxazole.
| Compound Name | 2-(1-chloroethyl)-5-(4-methylsulfonylphenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 43326970 |
| Molecular Formula | C12H12ClNO3S |
| Molecular Weight | 285.75 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | 2-(1-chloroethyl)-5-(4-methylsulfonylphenyl)-1,3-oxazole |
| SMILES | CC(Cl)c1ncc(-c2ccc(S(C)(=O)=O)cc2)o1 |
| InChI | InChI=1S/C12H12ClNO3S/c1-8(13)12-14-7-11(17-12)9-3-5-10(6-4-9)18(2,15)16/h3-8H,1-2H3 |
| InChIKey | RJZGFHRAKSJISJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.75 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|