C15H18ClNO — CID 102537709
5-(4-butan-2-ylphenyl)-2-(1-chloroethyl)-1,3-oxazole (PubChem CID 102537709) has the molecular formula C15H18ClNO and a molecular weight of 263.77 g/mol. Its IUPAC name is 5-(4-butan-2-ylphenyl)-2-(1-chloroethyl)-1,3-oxazole.
| Compound Name | 5-(4-butan-2-ylphenyl)-2-(1-chloroethyl)-1,3-oxazole |
|---|---|
| PubChem CID | 102537709 |
| Molecular Formula | C15H18ClNO |
| Molecular Weight | 263.77 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 5-(4-butan-2-ylphenyl)-2-(1-chloroethyl)-1,3-oxazole |
| SMILES | CCC(C)c1ccc(-c2cnc(C(C)Cl)o2)cc1 |
| InChI | InChI=1S/C15H18ClNO/c1-4-10(2)12-5-7-13(8-6-12)14-9-17-15(18-14)11(3)16/h5-11H,4H2,1-3H3 |
| InChIKey | OKETYTPYHABHCY-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.77 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|