C12H21F4NO — CID 43329445
[4-ethyl-2-(2,2,3,3-tetrafluoropropoxy)cyclohexyl]methanamine (PubChem CID 43329445) has the molecular formula C12H21F4NO and a molecular weight of 271.30 g/mol. Its IUPAC name is [4-ethyl-2-(2,2,3,3-tetrafluoropropoxy)cyclohexyl]methanamine.
| Compound Name | [4-ethyl-2-(2,2,3,3-tetrafluoropropoxy)cyclohexyl]methanamine |
|---|---|
| PubChem CID | 43329445 |
| Molecular Formula | C12H21F4NO |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | [4-ethyl-2-(2,2,3,3-tetrafluoropropoxy)cyclohexyl]methanamine |
| SMILES | CCC1CCC(CN)C(OCC(F)(F)C(F)F)C1 |
| InChI | InChI=1S/C12H21F4NO/c1-2-8-3-4-9(6-17)10(5-8)18-7-12(15,16)11(13)14/h8-11H,2-7,17H2,1H3 |
| InChIKey | KHORKOGYNIRQAI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|