C11H20F3NO — CID 43428738
[4-ethyl-2-(2,2,2-trifluoroethoxy)cyclohexyl]methanamine (PubChem CID 43428738) has the molecular formula C11H20F3NO and a molecular weight of 239.28 g/mol. Its IUPAC name is [4-ethyl-2-(2,2,2-trifluoroethoxy)cyclohexyl]methanamine.
| Compound Name | [4-ethyl-2-(2,2,2-trifluoroethoxy)cyclohexyl]methanamine |
|---|---|
| PubChem CID | 43428738 |
| Molecular Formula | C11H20F3NO |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | [4-ethyl-2-(2,2,2-trifluoroethoxy)cyclohexyl]methanamine |
| SMILES | CCC1CCC(CN)C(OCC(F)(F)F)C1 |
| InChI | InChI=1S/C11H20F3NO/c1-2-8-3-4-9(6-15)10(5-8)16-7-11(12,13)14/h8-10H,2-7,15H2,1H3 |
| InChIKey | JRCPOGRSWKPABZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |