C12H9F3N2O3 — CID 43338769
7-(3,3,3-trifluoropropanoyl)-1,5-dihydro-1,5-benzodiazepine-2,4-dione (PubChem CID 43338769) has the molecular formula C12H9F3N2O3 and a molecular weight of 286.21 g/mol. Its IUPAC name is 7-(3,3,3-trifluoropropanoyl)-1,5-dihydro-1,5-benzodiazepine-2,4-dione.
| Compound Name | 7-(3,3,3-trifluoropropanoyl)-1,5-dihydro-1,5-benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 43338769 |
| Molecular Formula | C12H9F3N2O3 |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 7-(3,3,3-trifluoropropanoyl)-1,5-dihydro-1,5-benzodiazepine-2,4-dione |
| SMILES | O=C1CC(=O)Nc2cc(C(=O)CC(F)(F)F)ccc2N1 |
| InChI | InChI=1S/C12H9F3N2O3/c13-12(14,15)5-9(18)6-1-2-7-8(3-6)17-11(20)4-10(19)16-7/h1-3H,4-5H2,(H,16,19)(H,17,20) |
| InChIKey | ZQGBJLUNZKFSQI-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|