C15H16N2O3 — CID 43338771
7-(cyclopentanecarbonyl)-1,5-dihydro-1,5-benzodiazepine-2,4-dione (PubChem CID 43338771) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is 7-(cyclopentanecarbonyl)-1,5-dihydro-1,5-benzodiazepine-2,4-dione.
| Compound Name | 7-(cyclopentanecarbonyl)-1,5-dihydro-1,5-benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 43338771 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 7-(cyclopentanecarbonyl)-1,5-dihydro-1,5-benzodiazepine-2,4-dione |
| SMILES | O=C1CC(=O)Nc2cc(C(=O)C3CCCC3)ccc2N1 |
| InChI | InChI=1S/C15H16N2O3/c18-13-8-14(19)17-12-7-10(5-6-11(12)16-13)15(20)9-3-1-2-4-9/h5-7,9H,1-4,8H2,(H,16,18)(H,17,19) |
| InChIKey | MEEDDFSZRKOKIY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|