C13H12F3NO4 — CID 43341197
1-[(2,4,5-trifluoro-3-hydroxybenzoyl)amino]cyclopentane-1-carboxylic acid (PubChem CID 43341197) has the molecular formula C13H12F3NO4 and a molecular weight of 303.24 g/mol. Its IUPAC name is 1-[(2,4,5-trifluoro-3-hydroxybenzoyl)amino]cyclopentane-1-carboxylic acid.
| Compound Name | 1-[(2,4,5-trifluoro-3-hydroxybenzoyl)amino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 43341197 |
| Molecular Formula | C13H12F3NO4 |
| Molecular Weight | 303.24 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 1-[(2,4,5-trifluoro-3-hydroxybenzoyl)amino]cyclopentane-1-carboxylic acid |
| SMILES | O=C(NC1(C(=O)O)CCCC1)c1cc(F)c(F)c(O)c1F |
| InChI | InChI=1S/C13H12F3NO4/c14-7-5-6(8(15)10(18)9(7)16)11(19)17-13(12(20)21)3-1-2-4-13/h5,18H,1-4H2,(H,17,19)(H,20,21) |
| InChIKey | OTHNJMJTEFNSLV-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.24 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|