C14H21NO3 — CID 43341626
1-[[(2E,4E)-hexa-2,4-dienoyl]amino]cycloheptane-1-carboxylic acid (PubChem CID 43341626) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 1-[[(2E,4E)-hexa-2,4-dienoyl]amino]cycloheptane-1-carboxylic acid.
| Compound Name | 1-[[(2E,4E)-hexa-2,4-dienoyl]amino]cycloheptane-1-carboxylic acid |
|---|---|
| PubChem CID | 43341626 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 1-[[(2E,4E)-hexa-2,4-dienoyl]amino]cycloheptane-1-carboxylic acid |
| SMILES | C/C=C/C=C/C(=O)NC1(C(=O)O)CCCCCC1 |
| InChI | InChI=1S/C14H21NO3/c1-2-3-6-9-12(16)15-14(13(17)18)10-7-4-5-8-11-14/h2-3,6,9H,4-5,7-8,10-11H2,1H3,(H,15,16)(H,17,18)/b3-2+,9-6+ |
| InChIKey | PBKHELVSYODUOQ-SYWUFUJHSA-N |
| XLogP | 2.41 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|