C11H17NO3S — CID 47144364
(2E,4E)-N-(3-methyl-1,1-dioxothiolan-3-yl)hexa-2,4-dienamide (PubChem CID 47144364) has the molecular formula C11H17NO3S and a molecular weight of 243.33 g/mol. Its IUPAC name is (2E,4E)-N-(3-methyl-1,1-dioxothiolan-3-yl)hexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-(3-methyl-1,1-dioxothiolan-3-yl)hexa-2,4-dienamide |
|---|---|
| PubChem CID | 47144364 |
| Molecular Formula | C11H17NO3S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | (2E,4E)-N-(3-methyl-1,1-dioxothiolan-3-yl)hexa-2,4-dienamide |
| SMILES | C/C=C/C=C/C(=O)NC1(C)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H17NO3S/c1-3-4-5-6-10(13)12-11(2)7-8-16(14,15)9-11/h3-6H,7-9H2,1-2H3,(H,12,13)/b4-3+,6-5+ |
| InChIKey | VTRMFLGMTOYHBS-VNKDHWASSA-N |
| XLogP | 0.81 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|