C17H12FNO2 — CID 43342069
2,3-dihydro-1-benzofuran-2-yl-(6-fluoro-1H-indol-3-yl)methanone (PubChem CID 43342069) has the molecular formula C17H12FNO2 and a molecular weight of 281.29 g/mol. Its IUPAC name is 2,3-dihydro-1-benzofuran-2-yl-(6-fluoro-1H-indol-3-yl)methanone.
| Compound Name | 2,3-dihydro-1-benzofuran-2-yl-(6-fluoro-1H-indol-3-yl)methanone |
|---|---|
| PubChem CID | 43342069 |
| Molecular Formula | C17H12FNO2 |
| Molecular Weight | 281.29 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 2,3-dihydro-1-benzofuran-2-yl-(6-fluoro-1H-indol-3-yl)methanone |
| SMILES | O=C(c1c[nH]c2cc(F)ccc12)C1Cc2ccccc2O1 |
| InChI | InChI=1S/C17H12FNO2/c18-11-5-6-12-13(9-19-14(12)8-11)17(20)16-7-10-3-1-2-4-15(10)21-16/h1-6,8-9,16,19H,7H2 |
| InChIKey | BFXDCHYYWOSFQE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.29 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |