C9H11Cl2NOS — CID 43344806
(2,5-dichlorothiophen-3-yl)-(oxolan-2-yl)methanamine (PubChem CID 43344806) has the molecular formula C9H11Cl2NOS and a molecular weight of 252.17 g/mol. Its IUPAC name is (2,5-dichlorothiophen-3-yl)-(oxolan-2-yl)methanamine.
| Compound Name | (2,5-dichlorothiophen-3-yl)-(oxolan-2-yl)methanamine |
|---|---|
| PubChem CID | 43344806 |
| Molecular Formula | C9H11Cl2NOS |
| Molecular Weight | 252.17 g/mol |
| Exact Mass | 250.99 |
| IUPAC Name | (2,5-dichlorothiophen-3-yl)-(oxolan-2-yl)methanamine |
| SMILES | NC(c1cc(Cl)sc1Cl)C1CCCO1 |
| InChI | InChI=1S/C9H11Cl2NOS/c10-7-4-5(9(11)14-7)8(12)6-2-1-3-13-6/h4,6,8H,1-3,12H2 |
| InChIKey | QEAVGZGNTZPXNX-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.17 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |