C13H17Cl3S — CID 65022750
2,5-dichloro-3-[chloro(cyclooctyl)methyl]thiophene (PubChem CID 65022750) has the molecular formula C13H17Cl3S and a molecular weight of 311.71 g/mol. Its IUPAC name is 2,5-dichloro-3-[chloro(cyclooctyl)methyl]thiophene.
| Compound Name | 2,5-dichloro-3-[chloro(cyclooctyl)methyl]thiophene |
|---|---|
| PubChem CID | 65022750 |
| Molecular Formula | C13H17Cl3S |
| Molecular Weight | 311.71 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | 2,5-dichloro-3-[chloro(cyclooctyl)methyl]thiophene |
| SMILES | Clc1cc(C(Cl)C2CCCCCCC2)c(Cl)s1 |
| InChI | InChI=1S/C13H17Cl3S/c14-11-8-10(13(16)17-11)12(15)9-6-4-2-1-3-5-7-9/h8-9,12H,1-7H2 |
| InChIKey | ARZGQELNIHBDGM-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.71 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|