C12H15N3O5S — CID 43350647
6-methyl-4-(2-morpholin-4-yl-2-oxoethyl)sulfanyl-2-oxo-1H-pyrimidine-5-carboxylic acid (PubChem CID 43350647) has the molecular formula C12H15N3O5S and a molecular weight of 313.34 g/mol. Its IUPAC name is 6-methyl-4-(2-morpholin-4-yl-2-oxoethyl)sulfanyl-2-oxo-1H-pyrimidine-5-carboxylic acid.
| Compound Name | 6-methyl-4-(2-morpholin-4-yl-2-oxoethyl)sulfanyl-2-oxo-1H-pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 43350647 |
| Molecular Formula | C12H15N3O5S |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 6-methyl-4-(2-morpholin-4-yl-2-oxoethyl)sulfanyl-2-oxo-1H-pyrimidine-5-carboxylic acid |
| SMILES | Cc1[nH]c(=O)nc(SCC(=O)N2CCOCC2)c1C(=O)O |
| InChI | InChI=1S/C12H15N3O5S/c1-7-9(11(17)18)10(14-12(19)13-7)21-6-8(16)15-2-4-20-5-3-15/h2-6H2,1H3,(H,17,18)(H,13,14,19) |
| InChIKey | VKNDFKDEHCGRFU-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 112.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |