2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]acetic acid

C8H9N3O5 — CID 43354354

IUPAC2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]acetic acid
SMILESO=C(O)CNC(=O)Cn1[nH]c(=O)ccc1=O
InChIInChI=1S/C8H9N3O5/c12-5-1-2-7(14)11(10-5)4-6(13)9-3-8(15)16/h1-2H,3-4H2,(H,9,13)(H,10,12)(H,15,16)
InChIKeyXDYZBGCJTTWPNT-UHFFFAOYSA-N
MW227.18 g/mol
LogP-2.26
Rot. Bonds4

About 2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]acetic acid

2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]acetic acid (PubChem CID 43354354) has the molecular formula C8H9N3O5 and a molecular weight of 227.18 g/mol. Its IUPAC name is 2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]acetic acid.

Molecular Properties

Compound Name2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]acetic acid
PubChem CID43354354
Molecular FormulaC8H9N3O5
Molecular Weight227.18 g/mol
Exact Mass227.05
IUPAC Name2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]acetic acid
SMILESO=C(O)CNC(=O)Cn1[nH]c(=O)ccc1=O
InChIInChI=1S/C8H9N3O5/c12-5-1-2-7(14)11(10-5)4-6(13)9-3-8(15)16/h1-2H,3-4H2,(H,9,13)(H,10,12)(H,15,16)
InChIKeyXDYZBGCJTTWPNT-UHFFFAOYSA-N
XLogP-2.26
TPSA121.26 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.18
LogP ≤ 5-2.26
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze 2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]acetic acid?
The IUPAC name of 2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]acetic acid (CID 43354354) is 2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]acetic acid.
What is the SMILES notation for 2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]acetic acid?
The canonical SMILES for 2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]acetic acid is O=C(O)CNC(=O)Cn1[nH]c(=O)ccc1=O.
What is the InChIKey of 2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]acetic acid?
The InChIKey is XDYZBGCJTTWPNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O5/c12-5-1-2-7(14)11(10-5)4-6(13)9-3-8(15)16/h1-2H,3-4H2,(H,9,13)(H,10,12)(H,15,16).
What are the key properties of 2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]acetic acid?
2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]acetic acid has a molecular weight of 227.18 g/mol, XLogP of -2.26, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]acetic acid is sourced from PubChem (CID 43354354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).