C10H13N3O5 — CID 43355166
4-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]butanoic acid (PubChem CID 43355166) has the molecular formula C10H13N3O5 and a molecular weight of 255.23 g/mol. Its IUPAC name is 4-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]butanoic acid.
| Compound Name | 4-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 43355166 |
| Molecular Formula | C10H13N3O5 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 4-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)Cc1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C10H13N3O5/c14-7(11-3-1-2-9(16)17)4-6-5-8(15)13-10(18)12-6/h5H,1-4H2,(H,11,14)(H,16,17)(H2,12,13,15,18) |
| InChIKey | BXVOIZAFPSTRHT-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 132.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|