C12H15N3O6 — CID 115291699
4-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]oxane-4-carboxylic acid (PubChem CID 115291699) has the molecular formula C12H15N3O6 and a molecular weight of 297.27 g/mol. Its IUPAC name is 4-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]oxane-4-carboxylic acid.
| Compound Name | 4-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 115291699 |
| Molecular Formula | C12H15N3O6 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 4-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]oxane-4-carboxylic acid |
| SMILES | O=C(Cc1cc(=O)[nH]c(=O)[nH]1)NC1(C(=O)O)CCOCC1 |
| InChI | InChI=1S/C12H15N3O6/c16-8-5-7(13-11(20)14-8)6-9(17)15-12(10(18)19)1-3-21-4-2-12/h5H,1-4,6H2,(H,15,17)(H,18,19)(H2,13,14,16,20) |
| InChIKey | SWSNUABUOMDWHR-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 141.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |