C11H18N2O6S — CID 43358795
2-[(1-methyl-5-oxopyrrolidine-3-carbonyl)amino]-4-methylsulfonylbutanoic acid (PubChem CID 43358795) has the molecular formula C11H18N2O6S and a molecular weight of 306.34 g/mol. Its IUPAC name is 2-[(1-methyl-5-oxopyrrolidine-3-carbonyl)amino]-4-methylsulfonylbutanoic acid.
| Compound Name | 2-[(1-methyl-5-oxopyrrolidine-3-carbonyl)amino]-4-methylsulfonylbutanoic acid |
|---|---|
| PubChem CID | 43358795 |
| Molecular Formula | C11H18N2O6S |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 2-[(1-methyl-5-oxopyrrolidine-3-carbonyl)amino]-4-methylsulfonylbutanoic acid |
| SMILES | CN1CC(C(=O)NC(CCS(C)(=O)=O)C(=O)O)CC1=O |
| InChI | InChI=1S/C11H18N2O6S/c1-13-6-7(5-9(13)14)10(15)12-8(11(16)17)3-4-20(2,18)19/h7-8H,3-6H2,1-2H3,(H,12,15)(H,16,17) |
| InChIKey | NYIBIZBVLBNJJO-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |