C10H16FNO5S2 — CID 168674852
(2S)-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]-4-methylsulfanylbutanoic acid (PubChem CID 168674852) has the molecular formula C10H16FNO5S2 and a molecular weight of 313.37 g/mol. Its IUPAC name is (2S)-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 168674852 |
| Molecular Formula | C10H16FNO5S2 |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | (2S)-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@@H](C(=O)O)N1CC(CS(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C10H16FNO5S2/c1-18-3-2-8(10(14)15)12-5-7(4-9(12)13)6-19(11,16)17/h7-8H,2-6H2,1H3,(H,14,15)/t7?,8-/m0/s1 |
| InChIKey | SXECPPIWZXSZSK-MQWKRIRWSA-N |
| XLogP | 0.34 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |