C12H24N2O5S — CID 43360119
4-[[2-(methanesulfonamido)-4-methylpentanoyl]-methylamino]butanoic acid (PubChem CID 43360119) has the molecular formula C12H24N2O5S and a molecular weight of 308.40 g/mol. Its IUPAC name is 4-[[2-(methanesulfonamido)-4-methylpentanoyl]-methylamino]butanoic acid.
| Compound Name | 4-[[2-(methanesulfonamido)-4-methylpentanoyl]-methylamino]butanoic acid |
|---|---|
| PubChem CID | 43360119 |
| Molecular Formula | C12H24N2O5S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 4-[[2-(methanesulfonamido)-4-methylpentanoyl]-methylamino]butanoic acid |
| SMILES | CC(C)CC(NS(C)(=O)=O)C(=O)N(C)CCCC(=O)O |
| InChI | InChI=1S/C12H24N2O5S/c1-9(2)8-10(13-20(4,18)19)12(17)14(3)7-5-6-11(15)16/h9-10,13H,5-8H2,1-4H3,(H,15,16) |
| InChIKey | XGAHJDOWKSKNBA-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |