C6H4Br2N2O4S — CID 43363665
2,4-dibromo-6-nitrobenzenesulfonamide (PubChem CID 43363665) has the molecular formula C6H4Br2N2O4S and a molecular weight of 359.98 g/mol. Its IUPAC name is 2,4-dibromo-6-nitrobenzenesulfonamide.
| Compound Name | 2,4-dibromo-6-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 43363665 |
| Molecular Formula | C6H4Br2N2O4S |
| Molecular Weight | 359.98 g/mol |
| Exact Mass | 357.83 |
| IUPAC Name | 2,4-dibromo-6-nitrobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1c(Br)cc(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C6H4Br2N2O4S/c7-3-1-4(8)6(15(9,13)14)5(2-3)10(11)12/h1-2H,(H2,9,13,14) |
| InChIKey | SMJSSOSYHVUNML-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.98 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|