C14H16N2O2S2 — CID 43363863
N-(thiophen-2-ylmethyl)-1,2,3,4-tetrahydroquinoline-6-sulfonamide (PubChem CID 43363863) has the molecular formula C14H16N2O2S2 and a molecular weight of 308.43 g/mol. Its IUPAC name is N-(thiophen-2-ylmethyl)-1,2,3,4-tetrahydroquinoline-6-sulfonamide.
| Compound Name | N-(thiophen-2-ylmethyl)-1,2,3,4-tetrahydroquinoline-6-sulfonamide |
|---|---|
| PubChem CID | 43363863 |
| Molecular Formula | C14H16N2O2S2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | N-(thiophen-2-ylmethyl)-1,2,3,4-tetrahydroquinoline-6-sulfonamide |
| SMILES | O=S(=O)(NCc1cccs1)c1ccc2c(c1)CCCN2 |
| InChI | InChI=1S/C14H16N2O2S2/c17-20(18,16-10-12-4-2-8-19-12)13-5-6-14-11(9-13)3-1-7-15-14/h2,4-6,8-9,15-16H,1,3,7,10H2 |
| InChIKey | WGJLRKZPAXZBJL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |