C13H17NO — CID 43367769
3-(3,5-dimethylphenoxy)pentanenitrile (PubChem CID 43367769) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is 3-(3,5-dimethylphenoxy)pentanenitrile.
| Compound Name | 3-(3,5-dimethylphenoxy)pentanenitrile |
|---|---|
| PubChem CID | 43367769 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 3-(3,5-dimethylphenoxy)pentanenitrile |
| SMILES | CCC(CC#N)Oc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C13H17NO/c1-4-12(5-6-14)15-13-8-10(2)7-11(3)9-13/h7-9,12H,4-5H2,1-3H3 |
| InChIKey | AWKNDJKJFCRICV-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |