C8H11N3O2S — CID 43368087
3-(3,6-dioxo-1H-pyridazin-2-yl)-2-methylpropanethioamide (PubChem CID 43368087) has the molecular formula C8H11N3O2S and a molecular weight of 213.26 g/mol. Its IUPAC name is 3-(3,6-dioxo-1H-pyridazin-2-yl)-2-methylpropanethioamide.
| Compound Name | 3-(3,6-dioxo-1H-pyridazin-2-yl)-2-methylpropanethioamide |
|---|---|
| PubChem CID | 43368087 |
| Molecular Formula | C8H11N3O2S |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 3-(3,6-dioxo-1H-pyridazin-2-yl)-2-methylpropanethioamide |
| SMILES | CC(Cn1[nH]c(=O)ccc1=O)C(N)=S |
| InChI | InChI=1S/C8H11N3O2S/c1-5(8(9)14)4-11-7(13)3-2-6(12)10-11/h2-3,5H,4H2,1H3,(H2,9,14)(H,10,12) |
| InChIKey | ISSZKFVENFBVPD-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 80.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|