C14H14N2O3S — CID 43369436
N-[3-(2-amino-2-sulfanylideneethoxy)phenyl]-2-methylfuran-3-carboxamide (PubChem CID 43369436) has the molecular formula C14H14N2O3S and a molecular weight of 290.34 g/mol. Its IUPAC name is N-[3-(2-amino-2-sulfanylideneethoxy)phenyl]-2-methylfuran-3-carboxamide.
| Compound Name | N-[3-(2-amino-2-sulfanylideneethoxy)phenyl]-2-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 43369436 |
| Molecular Formula | C14H14N2O3S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | N-[3-(2-amino-2-sulfanylideneethoxy)phenyl]-2-methylfuran-3-carboxamide |
| SMILES | Cc1occc1C(=O)Nc1cccc(OCC(N)=S)c1 |
| InChI | InChI=1S/C14H14N2O3S/c1-9-12(5-6-18-9)14(17)16-10-3-2-4-11(7-10)19-8-13(15)20/h2-7H,8H2,1H3,(H2,15,20)(H,16,17) |
| InChIKey | LBQFHFDBGZXWIG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|