C13H10Br2N2O2S2 — CID 80534574
N-[3-(2-amino-2-sulfanylideneethoxy)phenyl]-4,5-dibromothiophene-2-carboxamide (PubChem CID 80534574) has the molecular formula C13H10Br2N2O2S2 and a molecular weight of 450.18 g/mol. Its IUPAC name is N-[3-(2-amino-2-sulfanylideneethoxy)phenyl]-4,5-dibromothiophene-2-carboxamide.
| Compound Name | N-[3-(2-amino-2-sulfanylideneethoxy)phenyl]-4,5-dibromothiophene-2-carboxamide |
|---|---|
| PubChem CID | 80534574 |
| Molecular Formula | C13H10Br2N2O2S2 |
| Molecular Weight | 450.18 g/mol |
| Exact Mass | 447.86 |
| IUPAC Name | N-[3-(2-amino-2-sulfanylideneethoxy)phenyl]-4,5-dibromothiophene-2-carboxamide |
| SMILES | NC(=S)COc1cccc(NC(=O)c2cc(Br)c(Br)s2)c1 |
| InChI | InChI=1S/C13H10Br2N2O2S2/c14-9-5-10(21-12(9)15)13(18)17-7-2-1-3-8(4-7)19-6-11(16)20/h1-5H,6H2,(H2,16,20)(H,17,18) |
| InChIKey | GEUFVYGOHHWXSF-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.18 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|