C12H16N2O3S2 — CID 43369819
2-[3-(1,1-dioxo-1,4-thiazinan-4-yl)phenoxy]ethanethioamide (PubChem CID 43369819) has the molecular formula C12H16N2O3S2 and a molecular weight of 300.40 g/mol. Its IUPAC name is 2-[3-(1,1-dioxo-1,4-thiazinan-4-yl)phenoxy]ethanethioamide.
| Compound Name | 2-[3-(1,1-dioxo-1,4-thiazinan-4-yl)phenoxy]ethanethioamide |
|---|---|
| PubChem CID | 43369819 |
| Molecular Formula | C12H16N2O3S2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 2-[3-(1,1-dioxo-1,4-thiazinan-4-yl)phenoxy]ethanethioamide |
| SMILES | NC(=S)COc1cccc(N2CCS(=O)(=O)CC2)c1 |
| InChI | InChI=1S/C12H16N2O3S2/c13-12(18)9-17-11-3-1-2-10(8-11)14-4-6-19(15,16)7-5-14/h1-3,8H,4-7,9H2,(H2,13,18) |
| InChIKey | BOGPYHQBNKFKDB-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|