C14H13ClN2OS — CID 43369949
6-(4-chloro-3,5-dimethylphenoxy)pyridine-3-carbothioamide (PubChem CID 43369949) has the molecular formula C14H13ClN2OS and a molecular weight of 292.79 g/mol. Its IUPAC name is 6-(4-chloro-3,5-dimethylphenoxy)pyridine-3-carbothioamide.
| Compound Name | 6-(4-chloro-3,5-dimethylphenoxy)pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 43369949 |
| Molecular Formula | C14H13ClN2OS |
| Molecular Weight | 292.79 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 6-(4-chloro-3,5-dimethylphenoxy)pyridine-3-carbothioamide |
| SMILES | Cc1cc(Oc2ccc(C(N)=S)cn2)cc(C)c1Cl |
| InChI | InChI=1S/C14H13ClN2OS/c1-8-5-11(6-9(2)13(8)15)18-12-4-3-10(7-17-12)14(16)19/h3-7H,1-2H3,(H2,16,19) |
| InChIKey | SONOIKMMJZZFGZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.79 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|