C5H11N3O2 — CID 43374242
2-amino-N-(2-amino-2-oxoethyl)-N-methylacetamide (PubChem CID 43374242) has the molecular formula C5H11N3O2 and a molecular weight of 145.16 g/mol. Its IUPAC name is 2-amino-N-(2-amino-2-oxoethyl)-N-methylacetamide.
| Compound Name | 2-amino-N-(2-amino-2-oxoethyl)-N-methylacetamide |
|---|---|
| PubChem CID | 43374242 |
| Molecular Formula | C5H11N3O2 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 2-amino-N-(2-amino-2-oxoethyl)-N-methylacetamide |
| SMILES | CN(CC(N)=O)C(=O)CN |
| InChI | InChI=1S/C5H11N3O2/c1-8(3-4(7)9)5(10)2-6/h2-3,6H2,1H3,(H2,7,9) |
| InChIKey | RBHQPQCBRGLGEY-UHFFFAOYSA-N |
| XLogP | -2.11 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |