C8H16N2O3 — CID 79200969
N-(2-amino-2-oxoethyl)-4-hydroxy-N-methylpentanamide (PubChem CID 79200969) has the molecular formula C8H16N2O3 and a molecular weight of 188.23 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-4-hydroxy-N-methylpentanamide.
| Compound Name | N-(2-amino-2-oxoethyl)-4-hydroxy-N-methylpentanamide |
|---|---|
| PubChem CID | 79200969 |
| Molecular Formula | C8H16N2O3 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-4-hydroxy-N-methylpentanamide |
| SMILES | CC(O)CCC(=O)N(C)CC(N)=O |
| InChI | InChI=1S/C8H16N2O3/c1-6(11)3-4-8(13)10(2)5-7(9)12/h6,11H,3-5H2,1-2H3,(H2,9,12) |
| InChIKey | GJQKBRRMMRSWTD-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |