4-[(1,1-dioxothiolan-3-yl)-ethylamino]-4-oxobutanoic acid

C10H17NO5S — CID 43399751

IUPAC4-[(1,1-dioxothiolan-3-yl)-ethylamino]-4-oxobutanoic acid
SMILESCCN(C(=O)CCC(=O)O)C1CCS(=O)(=O)C1
InChIInChI=1S/C10H17NO5S/c1-2-11(9(12)3-4-10(13)14)8-5-6-17(15,16)7-8/h8H,2-7H2,1H3,(H,13,14)
InChIKeyJXNRGIRZUCXIJC-UHFFFAOYSA-N
MW263.31 g/mol
LogP-0.11
Rot. Bonds5

About 4-[(1,1-dioxothiolan-3-yl)-ethylamino]-4-oxobutanoic acid

4-[(1,1-dioxothiolan-3-yl)-ethylamino]-4-oxobutanoic acid (PubChem CID 43399751) has the molecular formula C10H17NO5S and a molecular weight of 263.31 g/mol. Its IUPAC name is 4-[(1,1-dioxothiolan-3-yl)-ethylamino]-4-oxobutanoic acid.

Molecular Properties

Compound Name4-[(1,1-dioxothiolan-3-yl)-ethylamino]-4-oxobutanoic acid
PubChem CID43399751
Molecular FormulaC10H17NO5S
Molecular Weight263.31 g/mol
Exact Mass263.08
IUPAC Name4-[(1,1-dioxothiolan-3-yl)-ethylamino]-4-oxobutanoic acid
SMILESCCN(C(=O)CCC(=O)O)C1CCS(=O)(=O)C1
InChIInChI=1S/C10H17NO5S/c1-2-11(9(12)3-4-10(13)14)8-5-6-17(15,16)7-8/h8H,2-7H2,1H3,(H,13,14)
InChIKeyJXNRGIRZUCXIJC-UHFFFAOYSA-N
XLogP-0.11
TPSA91.75 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.31
LogP ≤ 5-0.11
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-[(1,1-dioxothiolan-3-yl)-ethylamino]-4-oxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(1,1-dioxothiolan-3-yl)-ethylamino]-4-oxobutanoic acid?
The IUPAC name of 4-[(1,1-dioxothiolan-3-yl)-ethylamino]-4-oxobutanoic acid (CID 43399751) is 4-[(1,1-dioxothiolan-3-yl)-ethylamino]-4-oxobutanoic acid.
What is the SMILES notation for 4-[(1,1-dioxothiolan-3-yl)-ethylamino]-4-oxobutanoic acid?
The canonical SMILES for 4-[(1,1-dioxothiolan-3-yl)-ethylamino]-4-oxobutanoic acid is CCN(C(=O)CCC(=O)O)C1CCS(=O)(=O)C1.
What is the InChIKey of 4-[(1,1-dioxothiolan-3-yl)-ethylamino]-4-oxobutanoic acid?
The InChIKey is JXNRGIRZUCXIJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO5S/c1-2-11(9(12)3-4-10(13)14)8-5-6-17(15,16)7-8/h8H,2-7H2,1H3,(H,13,14).
What are the key properties of 4-[(1,1-dioxothiolan-3-yl)-ethylamino]-4-oxobutanoic acid?
4-[(1,1-dioxothiolan-3-yl)-ethylamino]-4-oxobutanoic acid has a molecular weight of 263.31 g/mol, XLogP of -0.11, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1,1-dioxothiolan-3-yl)-ethylamino]-4-oxobutanoic acid is sourced from PubChem (CID 43399751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).