C11H14N2O4S — CID 43409771
methyl 2-[(5-acetamidothiophene-2-carbonyl)-methylamino]acetate (PubChem CID 43409771) has the molecular formula C11H14N2O4S and a molecular weight of 270.31 g/mol. Its IUPAC name is methyl 2-[(5-acetamidothiophene-2-carbonyl)-methylamino]acetate.
| Compound Name | methyl 2-[(5-acetamidothiophene-2-carbonyl)-methylamino]acetate |
|---|---|
| PubChem CID | 43409771 |
| Molecular Formula | C11H14N2O4S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | methyl 2-[(5-acetamidothiophene-2-carbonyl)-methylamino]acetate |
| SMILES | COC(=O)CN(C)C(=O)c1ccc(NC(C)=O)s1 |
| InChI | InChI=1S/C11H14N2O4S/c1-7(14)12-9-5-4-8(18-9)11(16)13(2)6-10(15)17-3/h4-5H,6H2,1-3H3,(H,12,14) |
| InChIKey | QCBVHHORMLWFDN-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |