C9H9N5O2 — CID 43410705
6-(pyridin-3-ylmethylamino)-2H-1,2,4-triazine-3,5-dione (PubChem CID 43410705) has the molecular formula C9H9N5O2 and a molecular weight of 219.20 g/mol. Its IUPAC name is 6-(pyridin-3-ylmethylamino)-2H-1,2,4-triazine-3,5-dione.
| Compound Name | 6-(pyridin-3-ylmethylamino)-2H-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 43410705 |
| Molecular Formula | C9H9N5O2 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 6-(pyridin-3-ylmethylamino)-2H-1,2,4-triazine-3,5-dione |
| SMILES | O=c1[nH]nc(NCc2cccnc2)c(=O)[nH]1 |
| InChI | InChI=1S/C9H9N5O2/c15-8-7(13-14-9(16)12-8)11-5-6-2-1-3-10-4-6/h1-4H,5H2,(H,11,13)(H2,12,14,15,16) |
| InChIKey | IAEHJKAFGLYFQE-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |