C13H9F2NO4S — CID 43414513
5-[[2-(difluoromethoxy)phenyl]carbamoyl]thiophene-2-carboxylic acid (PubChem CID 43414513) has the molecular formula C13H9F2NO4S and a molecular weight of 313.28 g/mol. Its IUPAC name is 5-[[2-(difluoromethoxy)phenyl]carbamoyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[[2-(difluoromethoxy)phenyl]carbamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 43414513 |
| Molecular Formula | C13H9F2NO4S |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | 5-[[2-(difluoromethoxy)phenyl]carbamoyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(C(=O)Nc2ccccc2OC(F)F)s1 |
| InChI | InChI=1S/C13H9F2NO4S/c14-13(15)20-8-4-2-1-3-7(8)16-11(17)9-5-6-10(21-9)12(18)19/h1-6,13H,(H,16,17)(H,18,19) |
| InChIKey | SUMSFTMLNUOAPU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |