C12H9F2NO2S2 — CID 107022248
N-[2-(difluoromethoxy)phenyl]-4-sulfanylthiophene-2-carboxamide (PubChem CID 107022248) has the molecular formula C12H9F2NO2S2 and a molecular weight of 301.34 g/mol. Its IUPAC name is N-[2-(difluoromethoxy)phenyl]-4-sulfanylthiophene-2-carboxamide.
| Compound Name | N-[2-(difluoromethoxy)phenyl]-4-sulfanylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 107022248 |
| Molecular Formula | C12H9F2NO2S2 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.00 |
| IUPAC Name | N-[2-(difluoromethoxy)phenyl]-4-sulfanylthiophene-2-carboxamide |
| SMILES | O=C(Nc1ccccc1OC(F)F)c1cc(S)cs1 |
| InChI | InChI=1S/C12H9F2NO2S2/c13-12(14)17-9-4-2-1-3-8(9)15-11(16)10-5-7(18)6-19-10/h1-6,12,18H,(H,15,16) |
| InChIKey | GGBMPMFGGBDRLG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|