C11H7F2NOS2 — CID 107022105
N-(2,6-difluorophenyl)-4-sulfanylthiophene-2-carboxamide (PubChem CID 107022105) has the molecular formula C11H7F2NOS2 and a molecular weight of 271.31 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-4-sulfanylthiophene-2-carboxamide.
| Compound Name | N-(2,6-difluorophenyl)-4-sulfanylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 107022105 |
| Molecular Formula | C11H7F2NOS2 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 270.99 |
| IUPAC Name | N-(2,6-difluorophenyl)-4-sulfanylthiophene-2-carboxamide |
| SMILES | O=C(Nc1c(F)cccc1F)c1cc(S)cs1 |
| InChI | InChI=1S/C11H7F2NOS2/c12-7-2-1-3-8(13)10(7)14-11(15)9-4-6(16)5-17-9/h1-5,16H,(H,14,15) |
| InChIKey | LEUUERKKABDOFP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|