C9H7ClN2S2 — CID 43427006
3-benzylsulfanyl-4-chloro-1,2,5-thiadiazole (PubChem CID 43427006) has the molecular formula C9H7ClN2S2 and a molecular weight of 242.76 g/mol. Its IUPAC name is 3-benzylsulfanyl-4-chloro-1,2,5-thiadiazole.
| Compound Name | 3-benzylsulfanyl-4-chloro-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 43427006 |
| Molecular Formula | C9H7ClN2S2 |
| Molecular Weight | 242.76 g/mol |
| Exact Mass | 241.97 |
| IUPAC Name | 3-benzylsulfanyl-4-chloro-1,2,5-thiadiazole |
| SMILES | Clc1nsnc1SCc1ccccc1 |
| InChI | InChI=1S/C9H7ClN2S2/c10-8-9(12-14-11-8)13-6-7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | MVBYEPJTWFLSDX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.76 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |