C11H19N3O — CID 43428358
1-(1-aminopentan-3-yl)-4,6-dimethylpyrimidin-2-one (PubChem CID 43428358) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 1-(1-aminopentan-3-yl)-4,6-dimethylpyrimidin-2-one.
| Compound Name | 1-(1-aminopentan-3-yl)-4,6-dimethylpyrimidin-2-one |
|---|---|
| PubChem CID | 43428358 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 1-(1-aminopentan-3-yl)-4,6-dimethylpyrimidin-2-one |
| SMILES | CCC(CCN)n1c(C)cc(C)nc1=O |
| InChI | InChI=1S/C11H19N3O/c1-4-10(5-6-12)14-9(3)7-8(2)13-11(14)15/h7,10H,4-6,12H2,1-3H3 |
| InChIKey | JEEHLDFHFKMQRZ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |