C9H8FN3S2 — CID 43443957
4-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanylmethyl)aniline (PubChem CID 43443957) has the molecular formula C9H8FN3S2 and a molecular weight of 241.32 g/mol. Its IUPAC name is 4-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanylmethyl)aniline.
| Compound Name | 4-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanylmethyl)aniline |
|---|---|
| PubChem CID | 43443957 |
| Molecular Formula | C9H8FN3S2 |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.01 |
| IUPAC Name | 4-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanylmethyl)aniline |
| SMILES | Nc1ccc(F)cc1CSc1nncs1 |
| InChI | InChI=1S/C9H8FN3S2/c10-7-1-2-8(11)6(3-7)4-14-9-13-12-5-15-9/h1-3,5H,4,11H2 |
| InChIKey | CLPUKQJPCXTWQU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|