C10H10FN3S2 — CID 64767657
5-fluoro-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]aniline (PubChem CID 64767657) has the molecular formula C10H10FN3S2 and a molecular weight of 255.34 g/mol. Its IUPAC name is 5-fluoro-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]aniline.
| Compound Name | 5-fluoro-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]aniline |
|---|---|
| PubChem CID | 64767657 |
| Molecular Formula | C10H10FN3S2 |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 5-fluoro-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]aniline |
| SMILES | Cc1nnc(SCc2ccc(F)cc2N)s1 |
| InChI | InChI=1S/C10H10FN3S2/c1-6-13-14-10(16-6)15-5-7-2-3-8(11)4-9(7)12/h2-4H,5,12H2,1H3 |
| InChIKey | BCHXZJIDBXQXHY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|