C12H9F2N3O2S3 — CID 140974497
2-(4,4-difluorobut-3-enylsulfanyl)-5-[2-(sulfonylamino)phenyl]-1,3,4-thiadiazole (PubChem CID 140974497) has the molecular formula C12H9F2N3O2S3 and a molecular weight of 361.42 g/mol. Its IUPAC name is 2-(4,4-difluorobut-3-enylsulfanyl)-5-[2-(sulfonylamino)phenyl]-1,3,4-thiadiazole.
| Compound Name | 2-(4,4-difluorobut-3-enylsulfanyl)-5-[2-(sulfonylamino)phenyl]-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 140974497 |
| Molecular Formula | C12H9F2N3O2S3 |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 360.98 |
| IUPAC Name | 2-(4,4-difluorobut-3-enylsulfanyl)-5-[2-(sulfonylamino)phenyl]-1,3,4-thiadiazole |
| SMILES | O=S(=O)=Nc1ccccc1-c1nnc(SCCC=C(F)F)s1 |
| InChI | InChI=1S/C12H9F2N3O2S3/c13-10(14)6-3-7-20-12-16-15-11(21-12)8-4-1-2-5-9(8)17-22(18)19/h1-2,4-6H,3,7H2 |
| InChIKey | WRZCUDGRXNPUCI-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 72.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|