C12H11F2N3O3S3 — CID 174378469
[4-[5-(4,4-difluorobut-3-enylsulfanyl)-1,3,4-thiadiazol-2-yl]phenyl]sulfamic acid (PubChem CID 174378469) has the molecular formula C12H11F2N3O3S3 and a molecular weight of 379.44 g/mol. Its IUPAC name is [4-[5-(4,4-difluorobut-3-enylsulfanyl)-1,3,4-thiadiazol-2-yl]phenyl]sulfamic acid.
| Compound Name | [4-[5-(4,4-difluorobut-3-enylsulfanyl)-1,3,4-thiadiazol-2-yl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 174378469 |
| Molecular Formula | C12H11F2N3O3S3 |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 378.99 |
| IUPAC Name | [4-[5-(4,4-difluorobut-3-enylsulfanyl)-1,3,4-thiadiazol-2-yl]phenyl]sulfamic acid |
| SMILES | O=S(=O)(O)Nc1ccc(-c2nnc(SCCC=C(F)F)s2)cc1 |
| InChI | InChI=1S/C12H11F2N3O3S3/c13-10(14)2-1-7-21-12-16-15-11(22-12)8-3-5-9(6-4-8)17-23(18,19)20/h2-6,17H,1,7H2,(H,18,19,20) |
| InChIKey | DDXWINHFZMHYTB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|