C12H15N3S3 — CID 138454430
4-[5-(butyldisulfanyl)-1,3,4-thiadiazol-2-yl]aniline (PubChem CID 138454430) has the molecular formula C12H15N3S3 and a molecular weight of 297.47 g/mol. Its IUPAC name is 4-[5-(butyldisulfanyl)-1,3,4-thiadiazol-2-yl]aniline.
| Compound Name | 4-[5-(butyldisulfanyl)-1,3,4-thiadiazol-2-yl]aniline |
|---|---|
| PubChem CID | 138454430 |
| Molecular Formula | C12H15N3S3 |
| Molecular Weight | 297.47 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 4-[5-(butyldisulfanyl)-1,3,4-thiadiazol-2-yl]aniline |
| SMILES | CCCCSSc1nnc(-c2ccc(N)cc2)s1 |
| InChI | InChI=1S/C12H15N3S3/c1-2-3-8-16-18-12-15-14-11(17-12)9-4-6-10(13)7-5-9/h4-7H,2-3,8,13H2,1H3 |
| InChIKey | RUYXEERYTLHKMC-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|