C12H10F2N3O2S3- — CID 57218980
2-(4,4-difluorobut-3-enylsulfanyl)-5-[4-(sulfinatoamino)phenyl]-1,3,4-thiadiazole (PubChem CID 57218980) has the molecular formula C12H10F2N3O2S3- and a molecular weight of 362.43 g/mol. Its IUPAC name is 2-(4,4-difluorobut-3-enylsulfanyl)-5-[4-(sulfinatoamino)phenyl]-1,3,4-thiadiazole.
| Compound Name | 2-(4,4-difluorobut-3-enylsulfanyl)-5-[4-(sulfinatoamino)phenyl]-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 57218980 |
| Molecular Formula | C12H10F2N3O2S3- |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 361.99 |
| IUPAC Name | 2-(4,4-difluorobut-3-enylsulfanyl)-5-[4-(sulfinatoamino)phenyl]-1,3,4-thiadiazole |
| SMILES | O=S([O-])Nc1ccc(-c2nnc(SCCC=C(F)F)s2)cc1 |
| InChI | InChI=1S/C12H11F2N3O2S3/c13-10(14)2-1-7-20-12-16-15-11(21-12)8-3-5-9(6-4-8)17-22(18)19/h2-6,17H,1,7H2,(H,18,19)/p-1 |
| InChIKey | SEHAPNGAEJQJRP-UHFFFAOYSA-M |
| XLogP | 3.67 |
| TPSA | 77.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|