C14H10FN3S — CID 21157876
4-[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]aniline (PubChem CID 21157876) has the molecular formula C14H10FN3S and a molecular weight of 271.32 g/mol. Its IUPAC name is 4-[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]aniline.
| Compound Name | 4-[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]aniline |
|---|---|
| PubChem CID | 21157876 |
| Molecular Formula | C14H10FN3S |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 4-[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]aniline |
| SMILES | Nc1ccc(-c2nnc(-c3ccc(F)cc3)s2)cc1 |
| InChI | InChI=1S/C14H10FN3S/c15-11-5-1-9(2-6-11)13-17-18-14(19-13)10-3-7-12(16)8-4-10/h1-8H,16H2 |
| InChIKey | DDXYWTAPOHDKBL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|