C12H12FN3S — CID 176617360
5-[5-[(1S,2S)-2-fluorocyclopropyl]-1,3,4-thiadiazol-2-yl]-2-methylaniline (PubChem CID 176617360) has the molecular formula C12H12FN3S and a molecular weight of 249.31 g/mol. Its IUPAC name is 5-[5-[(1S,2S)-2-fluorocyclopropyl]-1,3,4-thiadiazol-2-yl]-2-methylaniline.
| Compound Name | 5-[5-[(1S,2S)-2-fluorocyclopropyl]-1,3,4-thiadiazol-2-yl]-2-methylaniline |
|---|---|
| PubChem CID | 176617360 |
| Molecular Formula | C12H12FN3S |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 5-[5-[(1S,2S)-2-fluorocyclopropyl]-1,3,4-thiadiazol-2-yl]-2-methylaniline |
| SMILES | Cc1ccc(-c2nnc([C@H]3C[C@@H]3F)s2)cc1N |
| InChI | InChI=1S/C12H12FN3S/c1-6-2-3-7(4-10(6)14)11-15-16-12(17-11)8-5-9(8)13/h2-4,8-9H,5,14H2,1H3/t8-,9-/m0/s1 |
| InChIKey | QQYZGLZIXGEMFV-IUCAKERBSA-N |
| XLogP | 2.92 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|